4,6-Dichloro-1H-indole-2-carboxylic acid - Names and Identifiers
Name | 4,6-Dichloro-1H-indole-2-carboxylic acid
|
Synonyms | MDL 29951 4,6-Dicloroindole-2-Carboxylic 4,6-Dichloroindole-2-carboxylic 4,6-Dicloroindole-2-carboxylic acid 4,6-DICHLOROINDOLE-2-CARBOXYLIC ACID 6-Dichloro-1H-indole-2-carboxylic acid 4,6-DICHLORO-1H-INDOLE-2-CARBOXYLIC ACID 4,6-Dichloro-1H-indole-2-carboxylic acid 1H-Indole-2-carboxylicacid, 4,6-dichloro-
|
CAS | 101861-63-6
|
InChI | InChI=1/C9H5Cl2NO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14) |
4,6-Dichloro-1H-indole-2-carboxylic acid - Physico-chemical Properties
Molecular Formula | C9H5Cl2NO2
|
Molar Mass | 230.05 |
Density | 1.663±0.06 g/cm3(Predicted) |
Melting Point | 238-239 °C |
Boling Point | 476.9±40.0 °C(Predicted) |
Flash Point | 242.2°C |
Solubility | DMSO (Slightly, Methanol (Slightly, Heated) |
Vapor Presure | 6.64E-10mmHg at 25°C |
Appearance | Solid |
Color | Pale Beige |
pKa | 4.10±0.30(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.73 |
4,6-Dichloro-1H-indole-2-carboxylic acid - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | 22 - Harmful if swallowed
|
4,6-Dichloro-1H-indole-2-carboxylic acid - Introduction
4,6-dichloroindole -2-carboxylic acid is an organic compound with the chemical formula C10H5Cl2NO2.
Nature:
1. Appearance: Colorless crystalline solid.
2. melting point: about 210-220 ℃.
3. Solubility: Soluble in organic solvents such as alcohol, ether, ketone and benzene, insoluble in water.
Use:
4,6-dichloroindole-2-carboxylic acid is widely used in the field of organic synthesis, commonly used in the synthesis of indole derivatives, bioactive compounds and drug molecules.
Preparation Method:
A common method for preparing 4,6-dichloroindole -2-carboxylic acid is by reacting 4,6-dichloroquinoline with formic acid. The reaction conditions may be carried out without solvent or under acidic or basic conditions.
Safety Information:
1. 4,6-dichloro indole -2-carboxylic acid may cause irritation and damage to human body. Attention should be paid to avoid touching skin, eyes and respiratory tract.
2. in use and storage, to maintain a well-ventilated environment.
3. use should wear appropriate protective gloves and eye protection equipment, avoid inhalation of gas or dust.
4. If exposed or inhaled, rinse immediately with water and seek medical help.
Last Update:2024-04-09 15:17:50